| Item |
Size / Catalog # |
Species |
Price |
| Recombinant Mouse Frizzled 2/FZD2 Protein(C-Fc) |
TP04825 |
|
|
| Recombinant Mouse IAP/OA3/CD47 Protein(C-Fc) |
TP04826 |
|
$232 |
| Recombinant Human Mesothelin Protein |
TP04827 |
|
|
| Recombinant Mouse Leukocyte Mono Ig-Like Receptor 1/LMIR1/CD300a Protein(C-Fc) |
TP04828 |
|
|
| Recombinant Mouse Nephroblastoma Overexpressed Gene /NOV/CCN3/IGFBP-9 Protein(C-6His) |
TP04829 |
|
|
| Recombinant Mouse Nogo-66 Receptor/Reticulon 4 Receptor/NgR/RTN4R Protein(C-6His) |
TP04830 |
|
|
| Recombinant Mouse Nogo-66 Receptor/Reticulon 4 Receptor/NgR/RTN4R Protein(C-Fc) |
TP04831 |
|
|
| Recombinant Human EpCAM/TROP1/CD326 Protein(C-Fc) |
TP04832 |
|
$340 |
| Recombinant Mouse HLA class II histocompatibility antigen gamma chain Protein |
TP04833 |
|
|
| Recombinant Mouse Thymic Stromal Lymphopoietin Receptor/TSP R Protein(C-Fc) |
TP04834 |
|
|
| Recombinant Mouse Transforming Growth Factor-β Receptor Type II/TGFBR2 Protein(C-6His) |
TP04835 |
|
|
| Recombinant Mouse Transforming Growth Factor-β Receptor Type II/TGFBR2 Protein(C-Fc) |
TP04836 |
|
|
| Recombinant Mouse TREML2/TLT-2 Protein(C-6His) |
TP04837 |
|
|
| Recombinant Human S100 Calcium Binding Protein B Protein |
TP04838 |
|
|
| Recombinant Human Mesothelin/MSLN/CAK1/MPF Protein(C-6His) |
TP04839 |
|
$357 |
| Recombinant Human Mesothelin/MSLN/CAK1/MPF Protein(C-Fc) |
TP04840 |
|
$357 |
| Recombinant Mouse Activated Leukocyte Cell Adhesion Molecule Protein |
TP04841 |
|
|
| Recombinant Mouse Discoidin domain-containing receptor 2 Protein |
TP04842 |
|
|
| Recombinant Mouse Activin Receptor IB/Activin RIB/ALK-4/ACVR1B Protein(C-Fc) |
TP04843 |
|
|
| Recombinant Mouse Endothelial cell-specific molecule 1 Protein |
TP04844 |
|
|
| Recombinant Mouse B7-H3/CD276Protein(C-6His) |
TP04845 |
|
$232 |
| Recombinant Mouse Cadherin-3/P-Cadherin/CDH3 Protein(C-Fc) |
TP04846 |
|
|
| Recombinant Mouse CD83 Protein |
TP04847 |
|
$357 |
| Recombinant Human CD55/DAF Protein(C-6His) |
TP04848 |
|
$357 |
| Recombinant Human CEACAM3/CD66d Protein(C-6His) |
TP04849 |
|
|
| Recombinant Human Neuroligin-1/NLGN1 Protein(C-6His) |
TP04850 |
|
|
| Recombinant Human Neuroplastin/NPTN Protein(C-6His) |
TP04851 |
|
|
| Recombinant Human Heat-Responsive Protein 12/HRSP12 Protein(N-6His) |
TP04852 |
|
|
| Recombinant Rat M-CSF/CSF1 Protein |
TP04853 |
|
$306 |
| Recombinant Human CLEC3B/Tetranectin Protein(C-6His) |
TP04854 |
|
|
| Recombinant Human CLEC4E/Mincel Protein(C-6His) |
TP04855 |
|
|
| Recombinant Human Clusterin/ApoJ Protein(C-6His) |
TP04856 |
|
|
| Recombinant Human Tissue Factor Pathway Inhibitor 2/TFPI-2/PP5/REF-1 Protein(C-6His) |
TP04857 |
|
|
| Recombinant Human OX-2/MOX1/CD200 Protein(C-6His) |
TP04858 |
|
|
| Recombinant Human Coxsackievirus and Adenovirus Receptor/CAR/CXADR Protein(C-6His) |
TP04859 |
|
|
| Recombinant Human CRTAMV/CD355 Protein(C-6His) |
TP04860 |
|
|
| Recombinant Human C-X-C Motif Chemokine 10/CXCL10 Protein |
TP04861 |
|
$306 |
| Recombinant Human Leukocyte Immunoglobulin-Like Receptor Subfamily B Member 1 Protein |
TP04862 |
|
|
| Recombinant Human Insulin-Like Growth Factor-Binding Protein 4/IGFBP-4 Protein(C-6His) |
TP04863 |
|
|
| Recombinant Human Cystatin A Protein(N-6His) |
TP04864 |
|
|
| Recombinant Human Cystatin M/CST6 Protein(C-6His) |
TP04865 |
|
|
| Recombinant Human Protein Phosphatase 1A Protein |
TP04866 |
|
|
| Recombinant Human Cystatin SA/CST2 Protein(C-6His) |
TP04867 |
|
|
| Recombinant Human MHC Class I Polypeptide-Related Sequence A Protein |
TP04868 |
|
|
| Recombinant Human V-Set and Immunoglobulin Domain-Containing Protein 4 Protein |
TP04869 |
|
|
| Recombinant Human Angiogenin/ANG/RNASE5 Protein |
TP04870 |
|
|
| Recombinant Human VEGF-D/FIGF Protein(C-6His) |
TP04871 |
|
$309 |
| Recombinant Human Annexin A6/ANXA6 Protein(C-6His) |
TP04872 |
|
|
| Recombinant Human Junctional Adhesion Molecule B/JAM-B/CD322 Protein(C-6His) |
TP04873 |
|
|
| Recombinant Human Fc Receptor-Like Protein 1 Protein |
TP04874 |
|
$357 |
| Recombinant Human Anterior Gradient Protein 3 Homolog/AG-3/BCMP11/AGR3 Protein(C-6His) |
TP04875 |
|
|
| Recombinant Human Kallikrein 2/KLK2 Protein(C-6His) |
TP04876 |
|
|
| Recombinant Human EpCAM/TROP1/CD326 Protein(C-6His) |
TP04877 |
|
$340 |
| Recombinant Human Glycoprotein Non-Metastatic Melanoma Protein B Protein |
TP04878 |
|
|
| Recombinant Human Fibronectin Leucine Rich Transmembrane Protein 2 Protein |
TP04879 |
|
|
| Recombinant Human CD200 Receptor 1 Protein |
TP04880 |
|
$357 |
| Recombinant Human Cell Adhesion Molecule 3 Protein |
TP04881 |
|
|
| Recombinant Human Zinc-α-2-Glycoprotein/AZGP1/ZAG Protein(C-6His) |
TP04882 |
|
|
| Recombinant Human T-Cell Surface Glycoprotein CD8 beta Chain Protein |
TP04883 |
|
|
| Recombinant Human LAMP2/CD107b Protein(C-6His) |
TP04884 |
|
|
| Recombinant Human Bcl-2-Llike Protein 2/BCL2L2 Protein(C-6His) |
TP04885 |
|
|
| Recombinant Human Glioma Pathogenesis-Related Protein 1 Protein |
TP04886 |
|
|
| Recombinant Human Protocadherin-10/PCDH10 Protein(C-Fc) |
TP04887 |
|
|
| Recombinant Human PRV1/CD177 Protein(C-6His) |
TP04888 |
|
|
| Recombinant Human β-Defensin 4A Protein |
TP04889 |
|
|
| Recombinant Human Adipocyte Adhesion Molecule Protein |
TP04890 |
|
|
| Recombinant Human Asialoglycoprotein Receptor 1 Protein |
TP04891 |
|
|
| Recombinant Human Fc γ RIIIA/FCGR3A/CD16a Protein(C-6His) |
TP04892 |
|
$357 |
| Recombinant Human Brain-Specific Angiogenesis Inhibitor 3/BAI3 Protein(C-6His) |
TP04893 |
|
|
| Recombinant Human Fructose-1,6-Bisphosphatase 1/FBPase 1 Protein(C-6His) |
TP04894 |
|
|
| Recombinant Human Lipopolysaccharide-Binding Protein Protein |
TP04895 |
|
|
| Recombinant Human Cystatin D Protein |
TP04896 |
|
|
| Recombinant Human Fibroblast Growth Factor 12/FGF-12 Protein |
TP04897 |
|
|
| Recombinant Human BH3-Interacting Domain Death Agonist Protein |
TP04898 |
|
|
| Recombinant Human Nogo-66 Receptor/Reticulon 4 Receptor Protein |
TP04899 |
|
|
| Recombinant Human Fibroblast Growth Factor 21/FGF-21 Protein(N-6His) |
TP04900 |
|
$154 |
| Recombinant Human Retinol-Binding Protein 4 Protein |
TP04901 |
|
|
| Recombinant Human Intercellular Adhesion Molecule 1 Protein |
TP04902 |
|
|
| Recombinant Human Semaphorin 3C/SEMA3C Protein(C-6His) |
TP04903 |
|
|
| Recombinant Human Low Affinity Immunoglobulin Gamma Fc Region Receptor II-B Protein |
TP04904 |
|
$357 |
| Recombinant Human Mannose-Binding Protein C/MBL-2/MBP- C Protein(C-6His) |
TP04905 |
|
|
| Recombinant Human Carboxypeptidase B/CPB1 Protein(C-6His) |
TP04906 |
|
|
| Recombinant Human Cadherin-6 Protein |
TP04907 |
|
|
| Recombinant Human Multiple Inositol Polyphosphate Phosphatase 1/MINPP1 Protein(C-6His) |
TP04908 |
|
|
| Recombinant Human Sialic Acid Binding Ig-Like Lectin 3/Siglec-3/CD33 Protein(C-Fc-6His) |
TP04909 |
|
$306 |
| Recombinant Human N-Acetylglucosamine-6-Sulfatase/GNS Protein(C-6His) |
TP04910 |
|
|
| Recombinant Mouse Collagen Alpha-1(XVIII) Chain/EndostatinProtein(C-6His) |
TP04911 |
|
|
| Recombinant Human Nectin-3/PVRL3/CD113 Protein(C-6His) |
TP04912 |
|
$357 |
| Recombinant Human Nectin-4/PVRL4 Protein(C-6His) |
TP04913 |
|
|
| Recombinant Mouse Basigin Protein |
TP04914 |
|
|
| Recombinant Rat C-C motif chemokine 5 Protein |
TP04915 |
|
|
| Recombinant Mouse SLAM Family Member 7 Protein |
TP04916 |
|
|
| Recombinant Human Collectin-11/COLEC11 Protein(C-6His) |
TP04917 |
|
|
| Recombinant Mouse GITR/TNFRSF18/CD357 Protein(C-Fc-6His) |
TP04918 |
|
$185 |
| Recombinant Human Oncostatin-M-Specific Receptor Subunit β/OSMRB/IL-31RB Protein(C-6His) |
TP04919 |
|
|
| Recombinant Human T-lymphocyte Surface Antigen Ly-9/SLAMF3/CD229 Protein(C-6His) |
TP04920 |
|
|
| Recombinant Mouse HLADG/CD74 Protein(C-mFc-6His) |
TP04921 |
|
|
| Recombinant Human IL-1 Receptor-Like 2/IL-1RL2 Protein(C-Fc) |
TP04922 |
|
|
| Recombinant Human Granulocyte-Macrophage Colony-Stimulating Factor Receptor Subunit alhpa Protein |
TP04923 |
|
|
| Recombinant Human IL-2 Receptor Subunit α/IL-2RA/CD25 Protein(C-Fc) |
TP04924 |
|
|
| Recombinant Human Lymphocyte Activation Gene 3 Protein Protein |
TP04925 |
|
$216 |
| Recombinant Human IL-2 Receptor Subunit γ/IL-2RG/CD132 Protein(C-Fc-6His) |
TP04926 |
|
|
| Recombinant Human Fibroblast Growth Factor Receptor 3 Protein |
TP04927 |
|
|
| Recombinant Human Triggering Receptor Expressed On Myeloid 2/TREM-2 Protein(C-6His) |
TP04928 |
|
|
| Recombinant Human Ephrin type-A receptor 4 Protein |
TP04929 |
|
|
| Recombinant Human CMRF35-Like Molecule 9 Protein |
TP04930 |
|
|
| Recombinant Human Ephrin type-B receptor 2 Protein |
TP04931 |
|
|
| Recombinant Human Vascular Endothelial Growth Factor Receptor 2 Protein |
TP04932 |
|
|
| Recombinant Human Insulin-Like Growth Factor II/IGF2 Protein |
TP04933 |
|
$154 |
| Recombinant Mouse LAIR1 Protein(C-6His) |
TP04934 |
|
|
| Recombinant Human Death Receptor 3/DR3/TNFRSF25 Protein(C-Fc) |
TP04935 |
|
|
| Recombinant Mouse Lymphocyte Activation Gene 3/LAG-3/CD223 Protein(C-6His) |
TP04936 |
|
$185 |
| Recombinant Human Secreted and Transmembrane Protein 1 Protein |
TP04937 |
|
|
| Recombinant Human Parathyroid hormone 1 receptor Protein |
TP04938 |
|
|
| Recombinant Mouse Natural Cytotoxicity Triggering Receptor 1/NCR1Protein (C-6His) |
TP04939 |
|
|
| Recombinant Mouse NKG2D Ligand 1/NKG2DL/ULBP1 Protein(C-6His) |
TP04940 |
|
|
| Recombinant Human PRL Protein |
TP04941 |
|
|
| Recombinant Human Ephrin A Receptor 4/EphA4 Protein(C-Fc) |
TP04942 |
|
|
| Recombinant Human Ephrin A Receptor 8/EphA8 Protein(C-Fc) |
TP04943 |
|
|
| Recombinant Mouse SLAM Family Member 8/SLAMF8 Protein(C-6His) |
TP04944 |
|
|
| Recombinant Mouse TACI/TNFRSF13B/CD267 Protein(C-Fc) |
TP04945 |
|
|
| Recombinant Mouse Thymic Stromal Lymphopoietin/TSLP Protein(C-Fc) |
TP04946 |
|
|
| Recombinant Human Cytokine receptor common subunit gamma Protein |
TP04947 |
|
|
| Recombinant Human FGF R5/FGFRL1 Protein(C-6His) |
TP04948 |
|
|
| Recombinant Mouse VSIG4 Protein(C-6His) |
TP04949 |
|
|
| Recombinant Rat Stem Cell Factor/SCF Protein(C-6His) |
TP04950 |
|
|
| Recombinant Rat Granulocyte-Macrophage Colony-Stimulating Factor/GM-CSF Protein(C-6His) |
TP04951 |
|
$306 |
| Recombinant Human Calmodulin/CALM1 Protein |
TP04952 |
|
|
| Recombinant Human Semaphorin 4G/SEMA4G Protein(C-6His) |
TP04953 |
|
|
| Recombinant Human Myeloid Differentiation Protein 1/Lymphocyte Antigen 86 Protein |
TP04954 |
|
|
| Recombinant Human Semaphorin-4D/SEMA4D/CD100 Protein(C-Fc) |
TP04955 |
|
|
| Recombinant Human Vascular Endothelial Growth Factor Receptor 1 Protein |
TP04956 |
|
|
| Recombinant Human Galectin 9 Protein(C-6His) |
TP04957 |
|
$216 |
| Recombinant Human Galectin-3/LGALS3 Protein(C-6His, Cells) |
TP04958 |
|
|
| Recombinant Human Galectin-7/LGALS7 Protein |
TP04959 |
|
|
| Recombinant Human Galectin-8/LGALS8 Protein |
TP04960 |
|
|
| Recombinant Human Mothers Against Decapentaplegic Homolog 2/SMAD2 Protein(N-6His-Flag) |
TP04961 |
|
|
| Recombinant Human Mothers Against Decapentaplegic Homolog 3/SMAD3 Protein(N-6His-Flag) |
TP04962 |
|
|
| Recombinant Human Mucin-1/MUC-1 Protein(C-Fc) |
TP04963 |
|
|
| Recombinant Mouse B7-H4 Protein |
TP04964 |
|
$357 |
| Recombinant Human SLAM Family Member 5/SLAMF5/CD84 Protein(C-6His) |
TP04965 |
|
|
| Recombinant Human SLAM Family Member 6/SLAMF6/CD352/NTB-A Protein(C-Fc) |
TP04966 |
|
|
| Recombinant Mouse Semaphorin 4D Protein |
TP04967 |
|
|
| Recombinant Mouse T-lymphocyte surface antigen Ly-9 Protein |
TP04968 |
|
|
| Recombinant Human Natural Killer Cell Receptor 2B4/SLAMF4/CD244 Protein(C-6His) |
TP04969 |
|
$357 |
| Recombinant Mouse UCHL1 / PGP9.5 Protein (His tag) |
TP04970 |
|
|
| Recombinant Human USP7 / HAUSP Protein (aa 208-560, His & GST tag) |
TP04971 |
|
|
| Mouse ALK-6 / BMPR1B Protein (Fc Tag) |
TP04972 |
|
|
| Recombinant Rat TNFR1 / CD120a / TNFRSF1A Protein (His tag) |
TP04973 |
|
$247 |
| Recombinant Human UBE2G1 Protein |
TP04974 |
|
|
| Recombinant Human USP7 / HAUSP Protein (aa 208-560) |
TP04975 |
|
|
| Recombinant Human OTUB1 / OTB1 Protein (His tag) |
TP04976 |
|
|
| Recombinant Human Ubiquitin-Conjugating Enzyme E2 A Protein |
TP04977 |
|
|
| Recombinant Human Rad6 Protein (His Tag) |
TP04978 |
|
|
| Recombinant Human UBE2W Protein (His tag) |
TP04979 |
|
|
| Recombinant Human CD31 / PECAM1 Protein |
TP04980 |
|
$357 |
| Recombinant Human UBE2T Protein (His Tag) |
TP04981 |
|
|
| Recombinant Human MMP-3 Protein |
TP04982 |
|
|
| Recombinant Human EphA1 / Eph Receptor A1 Protein (Fc Tag) |
TP04983 |
|
|
| Recombinant Human UBE2M Protein |
TP04984 |
|
|
| Recombinant Human UBE2F Protein (His tag) |
TP04985 |
|
|
| Recombinant Human CALML3 Protein (His tag) |
TP04986 |
|
|
| Recombinant Human LIF Protein (His Tag) |
TP04987 |
|
$262 |
| Recombinant Mouse SLAM Family Member 2 Protein |
TP04988 |
|
$357 |
| Recombinant Human CD83/HB15 Protein(C-Fc) |
TP04989 |
|
$357 |
| Recombinant Human Growth Hormone/GH Protein |
TP04990 |
|
|
| Recombinant Mouse C-X3-C Motif Chemokine 1/CX3CL1/Fractalkine Protein(C-6His) |
TP04991 |
|
$201 |
| Recombinant Mouse T-Cell Surface Glycoprotein CD5 Protein |
TP04992 |
|
|
| Recombinant Human Neural Cell Adhesion Molecule 1/NCAM-1/CD56 Protein(C-6His) |
TP04993 |
|
|
| Recombinant Human CD99 Antigen-Like Protein 2/CD99L2 Protein(C-Fc) |
TP04994 |
|
$357 |
| Recombinant Human Guanidinoacetate N-Methyltransferase/GAMT Protein(N, C-6His) |
TP04995 |
|
|
| Recombinant Mouse Low affinity IgG Fc receptor III Protein |
TP04996 |
|
$584 |
| Recombinant Human CD99/MIC2 Protein(C-Fc) |
TP04997 |
|
$357 |
| Recombinant Human Neuritin 1-Like Protein/NRN1L Protein(C-6His) |
TP04998 |
|
|
| Recombinant Human Stem Cell Factor/SCF/c-Kit Ligand Protein(C-6His) |
TP04999 |
|
|
| Recombinant Human Sulfotransferase 1A2/SULT1A2 Protein(N-6His) |
TP05000 |
|
|
| Recombinant Human CEACAM5/CD66e/CEA Protein(C-6His) |
TP05001 |
|
|
| Recombinant Human Sulfotransferase 1C2/SULT1C2 Protein(N-6His) |
TP05002 |
|
|
| Recombinant Mouse Death Receptor 6 Protein |
TP05003 |
|
|
| Recombinant Human CEACAM5/CD66e/CEA Protein(C-Fc) |
TP05004 |
|
|
| Recombinant Mouse Poliovirus Receptor Protein |
TP05005 |
|
$357 |
| Recombinant Mouse DNAX Accessory Molecule-1 Protein |
TP05006 |
|
$357 |
| Recombinant Human Cerebral Dopamine Neurotrophic Factor/CDNF/ARMETL1 Protein(C-6His) |
TP05007 |
|
|
| Recombinant Mouse Ectodysplasin Receptor/EDAR Protein(C-Fc) |
TP05008 |
|
|
| Recombinant Human Syntaxin-7/STX7 Protein(N-6His) |
TP05009 |
|
|
| Recombinant Human Syntaxin-8/STX8 Protein |
TP05010 |
|
|
| Recombinant Rat T-lymphocyte Activation Antigen CD80/B7-1 Protein(C-6His) |
TP05011 |
|
$201 |
| Recombinant Mouse Ephrin-A3/EFNA3 Protein(C-Fc) |
TP05012 |
|
|
| Recombinant Mouse Tumor Necrosis Factor Receptor II Protein |
TP05013 |
|
|
| Recombinant Human Chloride Intracellular Channel Protein 1/CLIC1 Protein(N-6His) |
TP05014 |
|
|
| Recombinant Human Syntenin-1/SDCBP/SYCL/MDA9 Protein(C-6His) |
TP05015 |
|
|
| Recombinant Mouse Ephrin-A5/EFNA5 Protein(C-6His) |
TP05016 |
|
|
| Recombinant Human NKG2A & CD94 Heterodimer Protein(N-8His & N-Flag) |
TP05017 |
|
|
| Recombinant Human Tachykinin-3/TAC3 Protein(N-6His) |
TP05018 |
|
|
| Recombinant Mouse Interleukin-7 receptor subunit alpha Protein |
TP05019 |
|
|
| Recombinant Human NKG2D Ligand 1/NKG2DL/ULBP1 Protein(C-6His) |
TP05020 |
|
|
| Recombinant Mouse Low Affinity Immunoglobulin Gamma Fc Region Receptor IV Protein |
TP05021 |
|
$357 |
| Recombinant Mouse Fas/TNFRSF6/CD95 Protein (His Tag) |
TP05022 |
|
|
| Recombinant Human Hepatocyte Growth Factor Receptor/HGF R/cMet Protein |
TP05023 |
|
|
| Recombinant Human NKG2D Ligand 2/NKG2DL2/N2DL2 Protein(C-Fc) |
TP05024 |
|
|
| Recombinant Human Thiamin Pyrophosphokinase 1/TPK1 Protein(C-6His) |
TP05025 |
|
$397 |
| Recombinant Mouse Fc γ RII/CD32b/FCGR2 Protein(C-6His) |
TP05026 |
|
$357 |
| Recombinant Mouse CD5 antigen-like Protein |
TP05027 |
|
$357 |
| Recombinant Human Hepatoma-Derived Growth Factor/HDGF Protein(C-6His) |
TP05028 |
|
|
| Recombinant Human NPDC1/CAB1 Protein(C-6His) |
TP05029 |
|
|
| Recombinant Human Clusterin/ApoJ Protein(C-Fc-6His) |
TP05030 |
|
|
| Recombinant Human Coagulation Factor IX/F9 Protein(C-6His) |
TP05031 |
|
|
| Recombinant Human Coiled-Coil Domain-Containing Protein 134/CCDC134 Protein(C-6His) |
TP05032 |
|
|
| Recombinant Human Nucleolar Protein Family A Member 2/NHP2/NOLA2 Protein(N-6His) |
TP05033 |
|
|
| Recombinant Human Complement Factor H-related 5/CFHR5 Protein(C-6His) |
TP05034 |
|
|
| Recombinant Human OX-2/MOX1/CD200 Protein(C-Fc) |
TP05035 |
|
|
| Recombinant Human IL-1 Receptor Type 1/IL-1R-1 Protein(C-Fc) |
TP05036 |
|
|
| Recombinant Human Copine-1/CPNE1 Protein(N, C-6His) |
TP05037 |
|
|
| Recombinant Human IL-1 Receptor Type 2/IL-1R-2 Protein(C-Fc) |
TP05038 |
|
|
| Recombinant Mouse IAP/OA3/CD47 Protein(C-6His) |
TP05039 |
|
$232 |
| Recombinant Human Palmitoyl-Protein Thioesterase 1/PPT1 Protein(C-6His) |
TP05040 |
|
|
| Recombinant Human Interferon alpha-4 Protein |
TP05041 |
|
$262 |
| Recombinant Human Transcobalamin II Receptor/TCblR/8D6A/CD320 Protein(C-6His) |
TP05042 |
|
|
| Recombinant Human Transcobalamin II Receptor/TCblR/8D6A/CD320 Protein(C-Fc) |
TP05043 |
|
|
| Recombinant Human Cryptic Protein Protein(C-6His) |
TP05044 |
|
|
| Recombinant Mouse IL-1 Receptor Type 2/IL-1 RII Protein(C-6His) |
TP05045 |
|
|
| Recombinant Human B7 Homolog 6 Protein |
TP05046 |
|
$306 |
| Recombinant Mouse IL-1 Receptor Type 2/IL-1R-2 Protein(C-Fc) |
TP05047 |
|
|
| Recombinant Human Parathyroid Hormone 1 Receptor/PTH1R Protein(Gly49, C-6His) |
TP05048 |
|
|
| Recombinant Mouse IL-1 Receptor-Like 1/IL-1RL1/IL-1 R4 Protein(C-6His) |
TP05049 |
|
|
| Recombinant Human Follistatin-like Protein 1 Protein |
TP05050 |
|
|
| Recombinant Human IL-20 receptor subunit beta/IL-20RB Protein(C-Fc) |
TP05051 |
|
|
| Recombinant Mouse IL-1 Receptor-Like 1/IL-1RL1/IL-1 R4 Protein(C-Fc) |
TP05052 |
|
|
| Recombinant Human IL-20 Receptor Subunit α α/IL20RA Protein(C-Fc) |
TP05053 |
|
|
| Recombinant Mouse IL-12 Receptor Subunit β2/IL-12RB2 Protein(C-Fc) |
TP05054 |
|
|
| Recombinant Human C-X-C Motif Chemokine 10/CXCL10 Protein(C-Fc-6His) |
TP05055 |
|
$306 |
| Recombinant Human IL-23 Recetor/IL-23R Protein(C-6His) |
TP05056 |
|
|
| Recombinant Human Parvulin-14/PIN4 Protein(N-6His) |
TP05057 |
|
|
| Recombinant Mouse IL-23 Receptor/IL-23R Protein(C-Fc) |
TP05058 |
|
|
| Recombinant Human IL-23 Recetor/IL-23R Protein(C-Fc) |
TP05059 |
|
|
| Recombinant Human PDCD1/PD-1/CD279 Protein(C-6His) |
TP05060 |
|
$357 |
| Recombinant Human TREML1/TLT-1 Protein(C-Fc) |
TP05061 |
|
|
| Recombinant Human TREML2/TLT-2 Protein(C-Fc) |
TP05062 |
|
|
| Recombinant Human PDCD1/PD-1/CD279 Protein(C-mFc) |
TP05063 |
|
$357 |
| Recombinant Human Butyrophilin subfamily 3 member A3 Protein |
TP05064 |
|
|
| Recombinant Human C-X-C Motif Chemokine 5/CXCL5 Protein |
TP05065 |
|
$306 |
| Recombinant Human Leucine-rich alpha-2-glycoprotein Protein |
TP05066 |
|
|
| Recombinant Human PDCD5/TFAR19 Protein(N-6His) |
TP05067 |
|
|
| Recombinant Human Casein kinase I isoform gamma-2 Protein |
TP05068 |
|
$397 |
| Recombinant Mouse Interferon γ/IFNγ Protein |
TP05069 |
|
$93 |
| Recombinant Human Peptidyl-Prolyl Cis-Trans Isomerase D/PPID/PPIase D Protein(N, C-6His) |
TP05070 |
|
|
| Recombinant Human Izumo sperm-egg fusion protein 4 Protein |
TP05071 |
|
|
| Recombinant Human Tumor Necrosis Factor Receptor I/TNFRSF1A/CD120a Protein(C-Fc) |
TP05072 |
|
$340 |
| Recombinant Human Cyr61/CCN1 Protein(C-Fc) |
TP05073 |
|
|
| Recombinant Human Cystathionine γ-Lyase/CTH Protein |
TP05074 |
|
|
